C13H20FN3O2 — CID 115360512
3-fluoro-N'-hydroxy-4-[[(3-hydroxy-2,2-dimethylpropyl)amino]methyl]benzenecarboximidamide (PubChem CID 115360512) has the molecular formula C13H20FN3O2 and a molecular weight of 269.32 g/mol. Its IUPAC name is 3-fluoro-N'-hydroxy-4-[[(3-hydroxy-2,2-dimethylpropyl)amino]methyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-N'-hydroxy-4-[[(3-hydroxy-2,2-dimethylpropyl)amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 115360512 |
| Molecular Formula | C13H20FN3O2 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-fluoro-N'-hydroxy-4-[[(3-hydroxy-2,2-dimethylpropyl)amino]methyl]benzenecarboximidamide |
| SMILES | CC(C)(CO)CNCc1ccc(/C(N)=N/O)cc1F |
| InChI | InChI=1S/C13H20FN3O2/c1-13(2,8-18)7-16-6-10-4-3-9(5-11(10)14)12(15)17-19/h3-5,16,18-19H,6-8H2,1-2H3,(H2,15,17) |
| InChIKey | RDWSCARUOZMBDO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|