C11H12F5N3O — CID 106293141
3-fluoro-N'-hydroxy-4-[(2,2,3,3-tetrafluoropropylamino)methyl]benzenecarboximidamide (PubChem CID 106293141) has the molecular formula C11H12F5N3O and a molecular weight of 297.23 g/mol. Its IUPAC name is 3-fluoro-N'-hydroxy-4-[(2,2,3,3-tetrafluoropropylamino)methyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-N'-hydroxy-4-[(2,2,3,3-tetrafluoropropylamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 106293141 |
| Molecular Formula | C11H12F5N3O |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-fluoro-N'-hydroxy-4-[(2,2,3,3-tetrafluoropropylamino)methyl]benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(CNCC(F)(F)C(F)F)c(F)c1 |
| InChI | InChI=1S/C11H12F5N3O/c12-8-3-6(9(17)19-20)1-2-7(8)4-18-5-11(15,16)10(13)14/h1-3,10,18,20H,4-5H2,(H2,17,19) |
| InChIKey | FEJYSFWDHCNKCH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|