C12H15F4N3O2 — CID 106293172
N'-hydroxy-4-methoxy-3-[(2,2,3,3-tetrafluoropropylamino)methyl]benzenecarboximidamide (PubChem CID 106293172) has the molecular formula C12H15F4N3O2 and a molecular weight of 309.26 g/mol. Its IUPAC name is N'-hydroxy-4-methoxy-3-[(2,2,3,3-tetrafluoropropylamino)methyl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-methoxy-3-[(2,2,3,3-tetrafluoropropylamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 106293172 |
| Molecular Formula | C12H15F4N3O2 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N'-hydroxy-4-methoxy-3-[(2,2,3,3-tetrafluoropropylamino)methyl]benzenecarboximidamide |
| SMILES | COc1ccc(/C(N)=N/O)cc1CNCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H15F4N3O2/c1-21-9-3-2-7(10(17)19-20)4-8(9)5-18-6-12(15,16)11(13)14/h2-4,11,18,20H,5-6H2,1H3,(H2,17,19) |
| InChIKey | AWXLDGXPPOFQKZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|