C14H12F3N3O — CID 77029354
4-[(3,5-difluoroanilino)methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 77029354) has the molecular formula C14H12F3N3O and a molecular weight of 295.26 g/mol. Its IUPAC name is 4-[(3,5-difluoroanilino)methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[(3,5-difluoroanilino)methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77029354 |
| Molecular Formula | C14H12F3N3O |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 4-[(3,5-difluoroanilino)methyl]-3-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(CNc2cc(F)cc(F)c2)c(F)c1 |
| InChI | InChI=1S/C14H12F3N3O/c15-10-4-11(16)6-12(5-10)19-7-9-2-1-8(3-13(9)17)14(18)20-21/h1-6,19,21H,7H2,(H2,18,20) |
| InChIKey | KGSKJFNSJKPRHG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|