C18H36FN3O2 — CID 165399364
ethane;3-fluoro-N'-hydroxy-4-[[3-hydroxypropyl(methyl)amino]methyl]benzenecarboximidamide (PubChem CID 165399364) has the molecular formula C18H36FN3O2 and a molecular weight of 345.50 g/mol. Its IUPAC name is ethane;3-fluoro-N'-hydroxy-4-[[3-hydroxypropyl(methyl)amino]methyl]benzenecarboximidamide.
| Compound Name | ethane;3-fluoro-N'-hydroxy-4-[[3-hydroxypropyl(methyl)amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 165399364 |
| Molecular Formula | C18H36FN3O2 |
| Molecular Weight | 345.50 g/mol |
| Exact Mass | 345.28 |
| IUPAC Name | ethane;3-fluoro-N'-hydroxy-4-[[3-hydroxypropyl(methyl)amino]methyl]benzenecarboximidamide |
| SMILES | CC.CC.CC.CN(CCCO)Cc1ccc(/C(N)=N/O)cc1F |
| InChI | InChI=1S/C12H18FN3O2.3C2H6/c1-16(5-2-6-17)8-10-4-3-9(7-11(10)13)12(14)15-18;3*1-2/h3-4,7,17-18H,2,5-6,8H2,1H3,(H2,14,15);3*1-2H3 |
| InChIKey | IPTGCUJCYFEQKD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|