C14H17FN4OS — CID 77009486
3-fluoro-N'-hydroxy-4-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarboximidamide (PubChem CID 77009486) has the molecular formula C14H17FN4OS and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-fluoro-N'-hydroxy-4-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-N'-hydroxy-4-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 77009486 |
| Molecular Formula | C14H17FN4OS |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 3-fluoro-N'-hydroxy-4-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarboximidamide |
| SMILES | Cc1ncsc1CN(C)Cc1ccc(C(N)=NO)cc1F |
| InChI | InChI=1S/C14H17FN4OS/c1-9-13(21-8-17-9)7-19(2)6-11-4-3-10(5-12(11)15)14(16)18-20/h3-5,8,20H,6-7H2,1-2H3,(H2,16,18) |
| InChIKey | ZEHWQGDAGHPHGK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|