C14H17FN4S — CID 63837980
3-fluoro-4-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarboximidamide (PubChem CID 63837980) has the molecular formula C14H17FN4S and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-fluoro-4-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-4-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 63837980 |
| Molecular Formula | C14H17FN4S |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-fluoro-4-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN(C)Cc2scnc2C)c(F)c1 |
| InChI | InChI=1S/C14H17FN4S/c1-9-13(20-8-18-9)7-19(2)6-11-4-3-10(14(16)17)5-12(11)15/h3-5,8H,6-7H2,1-2H3,(H3,16,17) |
| InChIKey | LTXKYGSVQXCFSP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|