C13H16N4S2 — CID 63837965
3-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]pyridine-2-carbothioamide (PubChem CID 63837965) has the molecular formula C13H16N4S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]pyridine-2-carbothioamide.
| Compound Name | 3-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 63837965 |
| Molecular Formula | C13H16N4S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]pyridine-2-carbothioamide |
| SMILES | Cc1ncsc1CN(C)Cc1cccnc1C(N)=S |
| InChI | InChI=1S/C13H16N4S2/c1-9-11(19-8-16-9)7-17(2)6-10-4-3-5-15-12(10)13(14)18/h3-5,8H,6-7H2,1-2H3,(H2,14,18) |
| InChIKey | IIJKEVZOBWVXHI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|