C14H16ClN3S2 — CID 102666263
3-chloro-4-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarbothioamide (PubChem CID 102666263) has the molecular formula C14H16ClN3S2 and a molecular weight of 325.89 g/mol. Its IUPAC name is 3-chloro-4-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarbothioamide.
| Compound Name | 3-chloro-4-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 102666263 |
| Molecular Formula | C14H16ClN3S2 |
| Molecular Weight | 325.89 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 3-chloro-4-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarbothioamide |
| SMILES | Cc1ncsc1CN(C)Cc1ccc(C(N)=S)cc1Cl |
| InChI | InChI=1S/C14H16ClN3S2/c1-9-13(20-8-17-9)7-18(2)6-11-4-3-10(14(16)19)5-12(11)15/h3-5,8H,6-7H2,1-2H3,(H2,16,19) |
| InChIKey | RQUBVXXRUFGITD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.89 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|