C14H16FN3S2 — CID 64763592
4-fluoro-2-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarbothioamide (PubChem CID 64763592) has the molecular formula C14H16FN3S2 and a molecular weight of 309.44 g/mol. Its IUPAC name is 4-fluoro-2-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarbothioamide.
| Compound Name | 4-fluoro-2-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 64763592 |
| Molecular Formula | C14H16FN3S2 |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-fluoro-2-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]benzenecarbothioamide |
| SMILES | Cc1ncsc1CN(C)Cc1cc(F)ccc1C(N)=S |
| InChI | InChI=1S/C14H16FN3S2/c1-9-13(20-8-17-9)7-18(2)6-10-5-11(15)3-4-12(10)14(16)19/h3-5,8H,6-7H2,1-2H3,(H2,16,19) |
| InChIKey | LMCZKCNTAUKMFQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|