C13H15N3S2 — CID 62893438
3-[[methyl(thiophen-3-ylmethyl)amino]methyl]pyridine-2-carbothioamide (PubChem CID 62893438) has the molecular formula C13H15N3S2 and a molecular weight of 277.42 g/mol. Its IUPAC name is 3-[[methyl(thiophen-3-ylmethyl)amino]methyl]pyridine-2-carbothioamide.
| Compound Name | 3-[[methyl(thiophen-3-ylmethyl)amino]methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 62893438 |
| Molecular Formula | C13H15N3S2 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3-[[methyl(thiophen-3-ylmethyl)amino]methyl]pyridine-2-carbothioamide |
| SMILES | CN(Cc1ccsc1)Cc1cccnc1C(N)=S |
| InChI | InChI=1S/C13H15N3S2/c1-16(7-10-4-6-18-9-10)8-11-3-2-5-15-12(11)13(14)17/h2-6,9H,7-8H2,1H3,(H2,14,17) |
| InChIKey | JPNSHQODRXJCKX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|