C12H16N4OS2 — CID 63840723
3-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]thiophene-2-carbohydrazide (PubChem CID 63840723) has the molecular formula C12H16N4OS2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 3-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]thiophene-2-carbohydrazide.
| Compound Name | 3-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 63840723 |
| Molecular Formula | C12H16N4OS2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-[[methyl-[(4-methyl-1,3-thiazol-5-yl)methyl]amino]methyl]thiophene-2-carbohydrazide |
| SMILES | Cc1ncsc1CN(C)Cc1ccsc1C(=O)NN |
| InChI | InChI=1S/C12H16N4OS2/c1-8-10(19-7-14-8)6-16(2)5-9-3-4-18-11(9)12(17)15-13/h3-4,7H,5-6,13H2,1-2H3,(H,15,17) |
| InChIKey | WFHCVZMWZQEPIB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|