C10H17N3O3S2 — CID 79858524
3-[[methyl(2-methylsulfonylethyl)amino]methyl]thiophene-2-carbohydrazide (PubChem CID 79858524) has the molecular formula C10H17N3O3S2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 3-[[methyl(2-methylsulfonylethyl)amino]methyl]thiophene-2-carbohydrazide.
| Compound Name | 3-[[methyl(2-methylsulfonylethyl)amino]methyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 79858524 |
| Molecular Formula | C10H17N3O3S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-[[methyl(2-methylsulfonylethyl)amino]methyl]thiophene-2-carbohydrazide |
| SMILES | CN(CCS(C)(=O)=O)Cc1ccsc1C(=O)NN |
| InChI | InChI=1S/C10H17N3O3S2/c1-13(4-6-18(2,15)16)7-8-3-5-17-9(8)10(14)12-11/h3,5H,4,6-7,11H2,1-2H3,(H,12,14) |
| InChIKey | CYJXTVMBJDZCRE-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|