C13H14FN3OS — CID 55246094
3-[(2-fluoro-N-methylanilino)methyl]thiophene-2-carbohydrazide (PubChem CID 55246094) has the molecular formula C13H14FN3OS and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[(2-fluoro-N-methylanilino)methyl]thiophene-2-carbohydrazide.
| Compound Name | 3-[(2-fluoro-N-methylanilino)methyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55246094 |
| Molecular Formula | C13H14FN3OS |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-[(2-fluoro-N-methylanilino)methyl]thiophene-2-carbohydrazide |
| SMILES | CN(Cc1ccsc1C(=O)NN)c1ccccc1F |
| InChI | InChI=1S/C13H14FN3OS/c1-17(11-5-3-2-4-10(11)14)8-9-6-7-19-12(9)13(18)16-15/h2-7H,8,15H2,1H3,(H,16,18) |
| InChIKey | KNIVUKLIDCZCNB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|