C12H13N3O3S2 — CID 52940435
N-[2-(hydrazinecarbonyl)thiophen-3-yl]-N-methylbenzenesulfonamide (PubChem CID 52940435) has the molecular formula C12H13N3O3S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[2-(hydrazinecarbonyl)thiophen-3-yl]-N-methylbenzenesulfonamide.
| Compound Name | N-[2-(hydrazinecarbonyl)thiophen-3-yl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 52940435 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-[2-(hydrazinecarbonyl)thiophen-3-yl]-N-methylbenzenesulfonamide |
| SMILES | CN(c1ccsc1C(=O)NN)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13N3O3S2/c1-15(10-7-8-19-11(10)12(16)14-13)20(17,18)9-5-3-2-4-6-9/h2-8H,13H2,1H3,(H,14,16) |
| InChIKey | GUHVBYDZJJIUDF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|