C10H17N3O4S — CID 79858792
5-[[methyl(2-methylsulfonylethyl)amino]methyl]furan-3-carbohydrazide (PubChem CID 79858792) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is 5-[[methyl(2-methylsulfonylethyl)amino]methyl]furan-3-carbohydrazide.
| Compound Name | 5-[[methyl(2-methylsulfonylethyl)amino]methyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 79858792 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 5-[[methyl(2-methylsulfonylethyl)amino]methyl]furan-3-carbohydrazide |
| SMILES | CN(CCS(C)(=O)=O)Cc1cc(C(=O)NN)co1 |
| InChI | InChI=1S/C10H17N3O4S/c1-13(3-4-18(2,15)16)6-9-5-8(7-17-9)10(14)12-11/h5,7H,3-4,6,11H2,1-2H3,(H,12,14) |
| InChIKey | HVZDUSVJGNTUSW-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|