C10H18N2O3S — CID 79858213
N-[[5-(aminomethyl)furan-2-yl]methyl]-N-methyl-2-methylsulfonylethanamine (PubChem CID 79858213) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is N-[[5-(aminomethyl)furan-2-yl]methyl]-N-methyl-2-methylsulfonylethanamine.
| Compound Name | N-[[5-(aminomethyl)furan-2-yl]methyl]-N-methyl-2-methylsulfonylethanamine |
|---|---|
| PubChem CID | 79858213 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-[[5-(aminomethyl)furan-2-yl]methyl]-N-methyl-2-methylsulfonylethanamine |
| SMILES | CN(CCS(C)(=O)=O)Cc1ccc(CN)o1 |
| InChI | InChI=1S/C10H18N2O3S/c1-12(5-6-16(2,13)14)8-10-4-3-9(7-11)15-10/h3-4H,5-8,11H2,1-2H3 |
| InChIKey | RZPTWXGBZHXCLF-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |