C11H20N2O2S2 — CID 107557165
N-methyl-N-[[5-(methylaminomethyl)thiophen-2-yl]methyl]-2-methylsulfonylethanamine (PubChem CID 107557165) has the molecular formula C11H20N2O2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is N-methyl-N-[[5-(methylaminomethyl)thiophen-2-yl]methyl]-2-methylsulfonylethanamine.
| Compound Name | N-methyl-N-[[5-(methylaminomethyl)thiophen-2-yl]methyl]-2-methylsulfonylethanamine |
|---|---|
| PubChem CID | 107557165 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-methyl-N-[[5-(methylaminomethyl)thiophen-2-yl]methyl]-2-methylsulfonylethanamine |
| SMILES | CNCc1ccc(CN(C)CCS(C)(=O)=O)s1 |
| InChI | InChI=1S/C11H20N2O2S2/c1-12-8-10-4-5-11(16-10)9-13(2)6-7-17(3,14)15/h4-5,12H,6-9H2,1-3H3 |
| InChIKey | PBYQEVNGUUSFFJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |