C15H22N2S2 — CID 107556485
N-[[5-(methylaminomethyl)thiophen-2-yl]methyl]-N-(thiophen-2-ylmethyl)propan-2-amine (PubChem CID 107556485) has the molecular formula C15H22N2S2 and a molecular weight of 294.49 g/mol. Its IUPAC name is N-[[5-(methylaminomethyl)thiophen-2-yl]methyl]-N-(thiophen-2-ylmethyl)propan-2-amine.
| Compound Name | N-[[5-(methylaminomethyl)thiophen-2-yl]methyl]-N-(thiophen-2-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 107556485 |
| Molecular Formula | C15H22N2S2 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[[5-(methylaminomethyl)thiophen-2-yl]methyl]-N-(thiophen-2-ylmethyl)propan-2-amine |
| SMILES | CNCc1ccc(CN(Cc2cccs2)C(C)C)s1 |
| InChI | InChI=1S/C15H22N2S2/c1-12(2)17(10-14-5-4-8-18-14)11-15-7-6-13(19-15)9-16-3/h4-8,12,16H,9-11H2,1-3H3 |
| InChIKey | ZOHAVOXZKCWGCI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |