C14H17FN2S — CID 107556414
2-fluoro-N-methyl-N-[[5-(methylaminomethyl)thiophen-2-yl]methyl]aniline (PubChem CID 107556414) has the molecular formula C14H17FN2S and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-fluoro-N-methyl-N-[[5-(methylaminomethyl)thiophen-2-yl]methyl]aniline.
| Compound Name | 2-fluoro-N-methyl-N-[[5-(methylaminomethyl)thiophen-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 107556414 |
| Molecular Formula | C14H17FN2S |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-fluoro-N-methyl-N-[[5-(methylaminomethyl)thiophen-2-yl]methyl]aniline |
| SMILES | CNCc1ccc(CN(C)c2ccccc2F)s1 |
| InChI | InChI=1S/C14H17FN2S/c1-16-9-11-7-8-12(18-11)10-17(2)14-6-4-3-5-13(14)15/h3-8,16H,9-10H2,1-2H3 |
| InChIKey | UCDLUBCRNZVXSU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |