C12H11FN2O2S3 — CID 63359251
3-fluoro-4-[(thiophen-2-ylsulfonylamino)methyl]benzenecarbothioamide (PubChem CID 63359251) has the molecular formula C12H11FN2O2S3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-fluoro-4-[(thiophen-2-ylsulfonylamino)methyl]benzenecarbothioamide.
| Compound Name | 3-fluoro-4-[(thiophen-2-ylsulfonylamino)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 63359251 |
| Molecular Formula | C12H11FN2O2S3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 3-fluoro-4-[(thiophen-2-ylsulfonylamino)methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(CNS(=O)(=O)c2cccs2)c(F)c1 |
| InChI | InChI=1S/C12H11FN2O2S3/c13-10-6-8(12(14)18)3-4-9(10)7-15-20(16,17)11-2-1-5-19-11/h1-6,15H,7H2,(H2,14,18) |
| InChIKey | LKGCEFJINRDLAD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|