C10H10N2O2S4 — CID 106270297
5-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carbothioamide (PubChem CID 106270297) has the molecular formula C10H10N2O2S4 and a molecular weight of 318.47 g/mol. Its IUPAC name is 5-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carbothioamide.
| Compound Name | 5-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106270297 |
| Molecular Formula | C10H10N2O2S4 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 5-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)NCc2cccs2)s1 |
| InChI | InChI=1S/C10H10N2O2S4/c11-10(15)8-3-4-9(17-8)18(13,14)12-6-7-2-1-5-16-7/h1-5,12H,6H2,(H2,11,15) |
| InChIKey | DAFQZIOEXHOQTM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|