C10H15N3O3S3 — CID 106272188
5-[(5-carbamothioylthiophen-2-yl)sulfonylamino]pentanamide (PubChem CID 106272188) has the molecular formula C10H15N3O3S3 and a molecular weight of 321.45 g/mol. Its IUPAC name is 5-[(5-carbamothioylthiophen-2-yl)sulfonylamino]pentanamide.
| Compound Name | 5-[(5-carbamothioylthiophen-2-yl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 106272188 |
| Molecular Formula | C10H15N3O3S3 |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 5-[(5-carbamothioylthiophen-2-yl)sulfonylamino]pentanamide |
| SMILES | NC(=O)CCCCNS(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C10H15N3O3S3/c11-8(14)3-1-2-6-13-19(15,16)9-5-4-7(18-9)10(12)17/h4-5,13H,1-3,6H2,(H2,11,14)(H2,12,17) |
| InChIKey | TVFLBAHBYQRGDI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|