C11H16N2O4S3 — CID 106271350
ethyl 4-[(5-carbamothioylthiophen-2-yl)sulfonylamino]butanoate (PubChem CID 106271350) has the molecular formula C11H16N2O4S3 and a molecular weight of 336.46 g/mol. Its IUPAC name is ethyl 4-[(5-carbamothioylthiophen-2-yl)sulfonylamino]butanoate.
| Compound Name | ethyl 4-[(5-carbamothioylthiophen-2-yl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 106271350 |
| Molecular Formula | C11H16N2O4S3 |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | ethyl 4-[(5-carbamothioylthiophen-2-yl)sulfonylamino]butanoate |
| SMILES | CCOC(=O)CCCNS(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C11H16N2O4S3/c1-2-17-9(14)4-3-7-13-20(15,16)10-6-5-8(19-10)11(12)18/h5-6,13H,2-4,7H2,1H3,(H2,12,18) |
| InChIKey | AELZOASLSDIZIL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|