C9H12N2O4S3 — CID 114166602
methyl 3-[(5-carbamothioylthiophen-2-yl)sulfonylamino]propanoate (PubChem CID 114166602) has the molecular formula C9H12N2O4S3 and a molecular weight of 308.41 g/mol. Its IUPAC name is methyl 3-[(5-carbamothioylthiophen-2-yl)sulfonylamino]propanoate.
| Compound Name | methyl 3-[(5-carbamothioylthiophen-2-yl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 114166602 |
| Molecular Formula | C9H12N2O4S3 |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | methyl 3-[(5-carbamothioylthiophen-2-yl)sulfonylamino]propanoate |
| SMILES | COC(=O)CCNS(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C9H12N2O4S3/c1-15-7(12)4-5-11-18(13,14)8-3-2-6(17-8)9(10)16/h2-3,11H,4-5H2,1H3,(H2,10,16) |
| InChIKey | MDAXQEIIKWVFOM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|