C11H15N3O3S3 — CID 106271482
3-[(5-carbamothioylthiophen-2-yl)sulfonylamino]-N-cyclopropylpropanamide (PubChem CID 106271482) has the molecular formula C11H15N3O3S3 and a molecular weight of 333.46 g/mol. Its IUPAC name is 3-[(5-carbamothioylthiophen-2-yl)sulfonylamino]-N-cyclopropylpropanamide.
| Compound Name | 3-[(5-carbamothioylthiophen-2-yl)sulfonylamino]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 106271482 |
| Molecular Formula | C11H15N3O3S3 |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 3-[(5-carbamothioylthiophen-2-yl)sulfonylamino]-N-cyclopropylpropanamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)NCCC(=O)NC2CC2)s1 |
| InChI | InChI=1S/C11H15N3O3S3/c12-11(18)8-3-4-10(19-8)20(16,17)13-6-5-9(15)14-7-1-2-7/h3-4,7,13H,1-2,5-6H2,(H2,12,18)(H,14,15) |
| InChIKey | ZGQYBASOOAHQAZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|