C13H18N2O4S2 — CID 64576394
ethyl 4-[(4-carbamothioylphenyl)sulfonylamino]butanoate (PubChem CID 64576394) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is ethyl 4-[(4-carbamothioylphenyl)sulfonylamino]butanoate.
| Compound Name | ethyl 4-[(4-carbamothioylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 64576394 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | ethyl 4-[(4-carbamothioylphenyl)sulfonylamino]butanoate |
| SMILES | CCOC(=O)CCCNS(=O)(=O)c1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C13H18N2O4S2/c1-2-19-12(16)4-3-9-15-21(17,18)11-7-5-10(6-8-11)13(14)20/h5-8,15H,2-4,9H2,1H3,(H2,14,20) |
| InChIKey | IUSYDESMCPNOIN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|