C16H17Cl2N3O5S — CID 43053510
ethyl 4-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]butanoate (PubChem CID 43053510) has the molecular formula C16H17Cl2N3O5S and a molecular weight of 434.30 g/mol. Its IUPAC name is ethyl 4-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]butanoate.
| Compound Name | ethyl 4-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]butanoate |
|---|---|
| PubChem CID | 43053510 |
| Molecular Formula | C16H17Cl2N3O5S |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | ethyl 4-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]butanoate |
| SMILES | CCOC(=O)CCCNS(=O)(=O)c1ccc(-n2ncc(Cl)c(Cl)c2=O)cc1 |
| InChI | InChI=1S/C16H17Cl2N3O5S/c1-2-26-14(22)4-3-9-20-27(24,25)12-7-5-11(6-8-12)21-16(23)15(18)13(17)10-19-21/h5-8,10,20H,2-4,9H2,1H3 |
| InChIKey | TURXNZUAAREUIZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|