C19H24Cl2N4O3S — CID 55895359
4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]benzenesulfonamide (PubChem CID 55895359) has the molecular formula C19H24Cl2N4O3S and a molecular weight of 459.40 g/mol. Its IUPAC name is 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]benzenesulfonamide.
| Compound Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55895359 |
| Molecular Formula | C19H24Cl2N4O3S |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]benzenesulfonamide |
| SMILES | CC1CCCN(CCCNS(=O)(=O)c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2)C1 |
| InChI | InChI=1S/C19H24Cl2N4O3S/c1-14-4-2-10-24(13-14)11-3-9-23-29(27,28)16-7-5-15(6-8-16)25-19(26)18(21)17(20)12-22-25/h5-8,12,14,23H,2-4,9-11,13H2,1H3 |
| InChIKey | RJALFWQOPNJIBR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|