C19H25Cl2N5O3S — CID 55681994
4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[4-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide (PubChem CID 55681994) has the molecular formula C19H25Cl2N5O3S and a molecular weight of 474.41 g/mol. Its IUPAC name is 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[4-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide.
| Compound Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[4-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55681994 |
| Molecular Formula | C19H25Cl2N5O3S |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-[4-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide |
| SMILES | CN1CCN(CCCCNS(=O)(=O)c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2)CC1 |
| InChI | InChI=1S/C19H25Cl2N5O3S/c1-24-10-12-25(13-11-24)9-3-2-8-23-30(28,29)16-6-4-15(5-7-16)26-19(27)18(21)17(20)14-22-26/h4-7,14,23H,2-3,8-13H2,1H3 |
| InChIKey | WDPCWZRZXGQXHP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|