C13H12Cl2N4O5S — CID 31689260
ethyl N-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]carbamate (PubChem CID 31689260) has the molecular formula C13H12Cl2N4O5S and a molecular weight of 407.24 g/mol. Its IUPAC name is ethyl N-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]carbamate.
| Compound Name | ethyl N-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]carbamate |
|---|---|
| PubChem CID | 31689260 |
| Molecular Formula | C13H12Cl2N4O5S |
| Molecular Weight | 407.24 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | ethyl N-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]carbamate |
| SMILES | CCOC(=O)NNS(=O)(=O)c1ccc(-n2ncc(Cl)c(Cl)c2=O)cc1 |
| InChI | InChI=1S/C13H12Cl2N4O5S/c1-2-24-13(21)17-18-25(22,23)9-5-3-8(4-6-9)19-12(20)11(15)10(14)7-16-19/h3-7,18H,2H2,1H3,(H,17,21) |
| InChIKey | SBEZZBHSUPAOAR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|