C18H14Cl2N4O4S — CID 55891962
4-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonyl-methylamino]benzamide (PubChem CID 55891962) has the molecular formula C18H14Cl2N4O4S and a molecular weight of 453.31 g/mol. Its IUPAC name is 4-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonyl-methylamino]benzamide.
| Compound Name | 4-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonyl-methylamino]benzamide |
|---|---|
| PubChem CID | 55891962 |
| Molecular Formula | C18H14Cl2N4O4S |
| Molecular Weight | 453.31 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | 4-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonyl-methylamino]benzamide |
| SMILES | CN(c1ccc(C(N)=O)cc1)S(=O)(=O)c1ccc(-n2ncc(Cl)c(Cl)c2=O)cc1 |
| InChI | InChI=1S/C18H14Cl2N4O4S/c1-23(12-4-2-11(3-5-12)17(21)25)29(27,28)14-8-6-13(7-9-14)24-18(26)16(20)15(19)10-22-24/h2-10H,1H3,(H2,21,25) |
| InChIKey | WBIPLYKWBGHRHR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |