C17H12Cl2N4O4S — CID 24662736
3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]benzamide (PubChem CID 24662736) has the molecular formula C17H12Cl2N4O4S and a molecular weight of 439.28 g/mol. Its IUPAC name is 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]benzamide.
| Compound Name | 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 24662736 |
| Molecular Formula | C17H12Cl2N4O4S |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 3-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)phenyl]sulfonylamino]benzamide |
| SMILES | NC(=O)c1cccc(NS(=O)(=O)c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2)c1 |
| InChI | InChI=1S/C17H12Cl2N4O4S/c18-14-9-21-23(17(25)15(14)19)12-4-6-13(7-5-12)28(26,27)22-11-3-1-2-10(8-11)16(20)24/h1-9,22H,(H2,20,24) |
| InChIKey | GBRDTFBONFVOAY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |