C16H10Cl2N4O5S — CID 31672101
4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(3-nitrophenyl)benzenesulfonamide (PubChem CID 31672101) has the molecular formula C16H10Cl2N4O5S and a molecular weight of 441.25 g/mol. Its IUPAC name is 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(3-nitrophenyl)benzenesulfonamide.
| Compound Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(3-nitrophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 31672101 |
| Molecular Formula | C16H10Cl2N4O5S |
| Molecular Weight | 441.25 g/mol |
| Exact Mass | 439.97 |
| IUPAC Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(3-nitrophenyl)benzenesulfonamide |
| SMILES | O=c1c(Cl)c(Cl)cnn1-c1ccc(S(=O)(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H10Cl2N4O5S/c17-14-9-19-21(16(23)15(14)18)11-4-6-13(7-5-11)28(26,27)20-10-2-1-3-12(8-10)22(24)25/h1-9,20H |
| InChIKey | KHRYFZRCMOUAHH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|