C17H15N3O7S — CID 39323493
(3S)-1-[4-[(3-nitrophenyl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 39323493) has the molecular formula C17H15N3O7S and a molecular weight of 405.39 g/mol. Its IUPAC name is (3S)-1-[4-[(3-nitrophenyl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-1-[4-[(3-nitrophenyl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 39323493 |
| Molecular Formula | C17H15N3O7S |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (3S)-1-[4-[(3-nitrophenyl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC(=O)N(c2ccc(S(=O)(=O)Nc3cccc([N+](=O)[O-])c3)cc2)C1 |
| InChI | InChI=1S/C17H15N3O7S/c21-16-8-11(17(22)23)10-19(16)13-4-6-15(7-5-13)28(26,27)18-12-2-1-3-14(9-12)20(24)25/h1-7,9,11,18H,8,10H2,(H,22,23)/t11-/m0/s1 |
| InChIKey | WJJOXQMUUKXWLL-NSHDSACASA-N |
| XLogP | 1.83 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|