C16H16N2O5S2 — CID 136516882
1-[4-[(4-methylthiophen-3-yl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 136516882) has the molecular formula C16H16N2O5S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-[4-[(4-methylthiophen-3-yl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-[4-[(4-methylthiophen-3-yl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 136516882 |
| Molecular Formula | C16H16N2O5S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 1-[4-[(4-methylthiophen-3-yl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | Cc1cscc1NS(=O)(=O)c1ccc(N2CC(C(=O)O)CC2=O)cc1 |
| InChI | InChI=1S/C16H16N2O5S2/c1-10-8-24-9-14(10)17-25(22,23)13-4-2-12(3-5-13)18-7-11(16(20)21)6-15(18)19/h2-5,8-9,11,17H,6-7H2,1H3,(H,20,21) |
| InChIKey | ZODJNIQXJMJDQF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |