C21H18N2O5S2 — CID 97256688
(3S)-5-oxo-1-[4-[(5-phenylthiophen-3-yl)sulfamoyl]phenyl]pyrrolidine-3-carboxylic acid (PubChem CID 97256688) has the molecular formula C21H18N2O5S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is (3S)-5-oxo-1-[4-[(5-phenylthiophen-3-yl)sulfamoyl]phenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-5-oxo-1-[4-[(5-phenylthiophen-3-yl)sulfamoyl]phenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97256688 |
| Molecular Formula | C21H18N2O5S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | (3S)-5-oxo-1-[4-[(5-phenylthiophen-3-yl)sulfamoyl]phenyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC(=O)N(c2ccc(S(=O)(=O)Nc3csc(-c4ccccc4)c3)cc2)C1 |
| InChI | InChI=1S/C21H18N2O5S2/c24-20-10-15(21(25)26)12-23(20)17-6-8-18(9-7-17)30(27,28)22-16-11-19(29-13-16)14-4-2-1-3-5-14/h1-9,11,13,15,22H,10,12H2,(H,25,26)/t15-/m0/s1 |
| InChIKey | WTNKDDBKHDMYNG-HNNXBMFYSA-N |
| XLogP | 3.65 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |