C17H15N3O3 — CID 168691777
5-oxo-1-(4-phenyldiazenylphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 168691777) has the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. Its IUPAC name is 5-oxo-1-(4-phenyldiazenylphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-oxo-1-(4-phenyldiazenylphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168691777 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5-oxo-1-(4-phenyldiazenylphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CC(=O)N(c2ccc(/N=N/c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C17H15N3O3/c21-16-10-12(17(22)23)11-20(16)15-8-6-14(7-9-15)19-18-13-4-2-1-3-5-13/h1-9,12H,10-11H2,(H,22,23)/b19-18+ |
| InChIKey | WOMOGULLTCMZSQ-VHEBQXMUSA-N |
| XLogP | 3.54 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|