C13H16N6O3 — CID 168602367
1-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 168602367) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168602367 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | NC(N)=N/C(N)=N/c1ccc(N2CC(C(=O)O)CC2=O)cc1 |
| InChI | InChI=1S/C13H16N6O3/c14-12(15)18-13(16)17-8-1-3-9(4-2-8)19-6-7(11(21)22)5-10(19)20/h1-4,7H,5-6H2,(H,21,22)(H6,14,15,16,17,18) |
| InChIKey | YRCJXQJMSSHSRK-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 160.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|