C17H14FN3O7S — CID 39324428
(3S)-1-[4-[(4-fluoro-3-nitrophenyl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 39324428) has the molecular formula C17H14FN3O7S and a molecular weight of 423.38 g/mol. Its IUPAC name is (3S)-1-[4-[(4-fluoro-3-nitrophenyl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-1-[4-[(4-fluoro-3-nitrophenyl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 39324428 |
| Molecular Formula | C17H14FN3O7S |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | (3S)-1-[4-[(4-fluoro-3-nitrophenyl)sulfamoyl]phenyl]-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC(=O)N(c2ccc(S(=O)(=O)Nc3ccc(F)c([N+](=O)[O-])c3)cc2)C1 |
| InChI | InChI=1S/C17H14FN3O7S/c18-14-6-1-11(8-15(14)21(25)26)19-29(27,28)13-4-2-12(3-5-13)20-9-10(17(23)24)7-16(20)22/h1-6,8,10,19H,7,9H2,(H,23,24)/t10-/m0/s1 |
| InChIKey | FXCNWCIJTSOZKP-JTQLQIEISA-N |
| XLogP | 1.97 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|