C11H5Cl3N2O2 — CID 18983164
4-(4,5-dichloro-6-oxopyridazin-1-yl)benzoyl chloride (PubChem CID 18983164) has the molecular formula C11H5Cl3N2O2 and a molecular weight of 303.53 g/mol. Its IUPAC name is 4-(4,5-dichloro-6-oxopyridazin-1-yl)benzoyl chloride.
| Compound Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)benzoyl chloride |
|---|---|
| PubChem CID | 18983164 |
| Molecular Formula | C11H5Cl3N2O2 |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 301.94 |
| IUPAC Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(-n2ncc(Cl)c(Cl)c2=O)cc1 |
| InChI | InChI=1S/C11H5Cl3N2O2/c12-8-5-15-16(11(18)9(8)13)7-3-1-6(2-4-7)10(14)17/h1-5H |
| InChIKey | ANJNPDBPYJOQEM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|