C18H20Cl2N4O2 — CID 154721643
4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-piperidin-1-ylethyl)benzamide (PubChem CID 154721643) has the molecular formula C18H20Cl2N4O2 and a molecular weight of 395.29 g/mol. Its IUPAC name is 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-piperidin-1-ylethyl)benzamide.
| Compound Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-piperidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 154721643 |
| Molecular Formula | C18H20Cl2N4O2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-piperidin-1-ylethyl)benzamide |
| SMILES | O=C(NCCN1CCCCC1)c1ccc(-n2ncc(Cl)c(Cl)c2=O)cc1 |
| InChI | InChI=1S/C18H20Cl2N4O2/c19-15-12-22-24(18(26)16(15)20)14-6-4-13(5-7-14)17(25)21-8-11-23-9-2-1-3-10-23/h4-7,12H,1-3,8-11H2,(H,21,25) |
| InChIKey | OMFVAWGFOUWANA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |