C11H14N2O2S3 — CID 43520972
5-(2-aminoethyl)-N-(thiophen-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 43520972) has the molecular formula C11H14N2O2S3 and a molecular weight of 302.45 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-(thiophen-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-(2-aminoethyl)-N-(thiophen-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43520972 |
| Molecular Formula | C11H14N2O2S3 |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 5-(2-aminoethyl)-N-(thiophen-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | NCCc1ccc(S(=O)(=O)NCc2cccs2)s1 |
| InChI | InChI=1S/C11H14N2O2S3/c12-6-5-9-3-4-11(17-9)18(14,15)13-8-10-2-1-7-16-10/h1-4,7,13H,5-6,8,12H2 |
| InChIKey | SDRZFFBMQLHETD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |