C12H12Br2N2O2S2 — CID 107601110
5-(2-aminoethyl)-N-(2,6-dibromophenyl)thiophene-2-sulfonamide (PubChem CID 107601110) has the molecular formula C12H12Br2N2O2S2 and a molecular weight of 440.18 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-(2,6-dibromophenyl)thiophene-2-sulfonamide.
| Compound Name | 5-(2-aminoethyl)-N-(2,6-dibromophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107601110 |
| Molecular Formula | C12H12Br2N2O2S2 |
| Molecular Weight | 440.18 g/mol |
| Exact Mass | 437.87 |
| IUPAC Name | 5-(2-aminoethyl)-N-(2,6-dibromophenyl)thiophene-2-sulfonamide |
| SMILES | NCCc1ccc(S(=O)(=O)Nc2c(Br)cccc2Br)s1 |
| InChI | InChI=1S/C12H12Br2N2O2S2/c13-9-2-1-3-10(14)12(9)16-20(17,18)11-5-4-8(19-11)6-7-15/h1-5,16H,6-7,15H2 |
| InChIKey | YMCRIIYOXLYKLN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |