C13H15FN2O2S2 — CID 79049510
5-(2-aminoethyl)-N-(3-fluoro-5-methylphenyl)thiophene-2-sulfonamide (PubChem CID 79049510) has the molecular formula C13H15FN2O2S2 and a molecular weight of 314.41 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-(3-fluoro-5-methylphenyl)thiophene-2-sulfonamide.
| Compound Name | 5-(2-aminoethyl)-N-(3-fluoro-5-methylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79049510 |
| Molecular Formula | C13H15FN2O2S2 |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 5-(2-aminoethyl)-N-(3-fluoro-5-methylphenyl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(F)cc(NS(=O)(=O)c2ccc(CCN)s2)c1 |
| InChI | InChI=1S/C13H15FN2O2S2/c1-9-6-10(14)8-11(7-9)16-20(17,18)13-3-2-12(19-13)4-5-15/h2-3,6-8,16H,4-5,15H2,1H3 |
| InChIKey | VUKPWUZYULXLFA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |