C13H13N3O2S3 — CID 107806361
5-(2-aminoethyl)-N-(1,3-benzothiazol-6-yl)thiophene-2-sulfonamide (PubChem CID 107806361) has the molecular formula C13H13N3O2S3 and a molecular weight of 339.47 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-(1,3-benzothiazol-6-yl)thiophene-2-sulfonamide.
| Compound Name | 5-(2-aminoethyl)-N-(1,3-benzothiazol-6-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107806361 |
| Molecular Formula | C13H13N3O2S3 |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 5-(2-aminoethyl)-N-(1,3-benzothiazol-6-yl)thiophene-2-sulfonamide |
| SMILES | NCCc1ccc(S(=O)(=O)Nc2ccc3ncsc3c2)s1 |
| InChI | InChI=1S/C13H13N3O2S3/c14-6-5-10-2-4-13(20-10)21(17,18)16-9-1-3-11-12(7-9)19-8-15-11/h1-4,7-8,16H,5-6,14H2 |
| InChIKey | QUUOMKXRICDAHK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |