C12H13N5O2S2 — CID 106089376
1-(2-aminoethyl)-N-(1,3-benzothiazol-6-yl)pyrazole-4-sulfonamide (PubChem CID 106089376) has the molecular formula C12H13N5O2S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-(1,3-benzothiazol-6-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-(2-aminoethyl)-N-(1,3-benzothiazol-6-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106089376 |
| Molecular Formula | C12H13N5O2S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 1-(2-aminoethyl)-N-(1,3-benzothiazol-6-yl)pyrazole-4-sulfonamide |
| SMILES | NCCn1cc(S(=O)(=O)Nc2ccc3ncsc3c2)cn1 |
| InChI | InChI=1S/C12H13N5O2S2/c13-3-4-17-7-10(6-15-17)21(18,19)16-9-1-2-11-12(5-9)20-8-14-11/h1-2,5-8,16H,3-4,13H2 |
| InChIKey | ANBKBMKQOUQGEC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |