C13H14N4O2S2 — CID 106003518
1-(2-aminoethyl)-N-(1-benzothiophen-5-yl)pyrazole-4-sulfonamide (PubChem CID 106003518) has the molecular formula C13H14N4O2S2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-(1-benzothiophen-5-yl)pyrazole-4-sulfonamide.
| Compound Name | 1-(2-aminoethyl)-N-(1-benzothiophen-5-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106003518 |
| Molecular Formula | C13H14N4O2S2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1-(2-aminoethyl)-N-(1-benzothiophen-5-yl)pyrazole-4-sulfonamide |
| SMILES | NCCn1cc(S(=O)(=O)Nc2ccc3sccc3c2)cn1 |
| InChI | InChI=1S/C13H14N4O2S2/c14-4-5-17-9-12(8-15-17)21(18,19)16-11-1-2-13-10(7-11)3-6-20-13/h1-3,6-9,16H,4-5,14H2 |
| InChIKey | JDAYGXKNFZLEQF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |