C13H12N4O2S2 — CID 65451533
N-(1-benzothiophen-5-yl)-2-hydrazinylpyridine-4-sulfonamide (PubChem CID 65451533) has the molecular formula C13H12N4O2S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is N-(1-benzothiophen-5-yl)-2-hydrazinylpyridine-4-sulfonamide.
| Compound Name | N-(1-benzothiophen-5-yl)-2-hydrazinylpyridine-4-sulfonamide |
|---|---|
| PubChem CID | 65451533 |
| Molecular Formula | C13H12N4O2S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | N-(1-benzothiophen-5-yl)-2-hydrazinylpyridine-4-sulfonamide |
| SMILES | NNc1cc(S(=O)(=O)Nc2ccc3sccc3c2)ccn1 |
| InChI | InChI=1S/C13H12N4O2S2/c14-16-13-8-11(3-5-15-13)21(18,19)17-10-1-2-12-9(7-10)4-6-20-12/h1-8,17H,14H2,(H,15,16) |
| InChIKey | RZYOCCXARJEXAG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|