C6H7N7O2S2 — CID 114912904
2-hydrazinyl-N-(thiatriazol-5-yl)pyridine-4-sulfonamide (PubChem CID 114912904) has the molecular formula C6H7N7O2S2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-hydrazinyl-N-(thiatriazol-5-yl)pyridine-4-sulfonamide.
| Compound Name | 2-hydrazinyl-N-(thiatriazol-5-yl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 114912904 |
| Molecular Formula | C6H7N7O2S2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 2-hydrazinyl-N-(thiatriazol-5-yl)pyridine-4-sulfonamide |
| SMILES | NNc1cc(S(=O)(=O)Nc2nnns2)ccn1 |
| InChI | InChI=1S/C6H7N7O2S2/c7-9-5-3-4(1-2-8-5)17(14,15)11-6-10-12-13-16-6/h1-3H,7H2,(H,8,9)(H,10,11,13) |
| InChIKey | GHAIWJHRUGROEC-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 135.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|